C11H14BN2O4+ — CID 152752164
2-(5-methyl-5-methyl-1,3,2-dioxaborinan-2-yl)-5-nitroaniline (PubChem CID 152752164) has the molecular formula C11H14BN2O4+ and a molecular weight of 249.06 g/mol. Its IUPAC name is 2-(5-methyl-5-methyl-1,3,2-dioxaborinan-2-yl)-5-nitroaniline.
| Compound Name | 2-(5-methyl-5-methyl-1,3,2-dioxaborinan-2-yl)-5-nitroaniline |
|---|---|
| PubChem CID | 152752164 |
| Molecular Formula | C11H14BN2O4+ |
| Molecular Weight | 249.06 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 2-(5-methyl-5-methyl-1,3,2-dioxaborinan-2-yl)-5-nitroaniline |
| SMILES | [CH2+]C1(C)COB(c2ccc([N+](=O)[O-])cc2N)OC1 |
| InChI | InChI=1S/C11H14BN2O4/c1-11(2)6-17-12(18-7-11)9-4-3-8(14(15)16)5-10(9)13/h3-5H,1,6-7,13H2,2H3/q+1 |
| InChIKey | PLYKQPQAZSEOFN-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.06 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|