C28H35N3O2S — CID 152768475
[(3R,4R)-4-[3-(dimethylamino)-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-2-ylprop-2-ynyl)piperidin-3-yl]methanol (PubChem CID 152768475) has the molecular formula C28H35N3O2S and a molecular weight of 477.67 g/mol. Its IUPAC name is [(3R,4R)-4-[3-(dimethylamino)-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-2-ylprop-2-ynyl)piperidin-3-yl]methanol.
| Compound Name | [(3R,4R)-4-[3-(dimethylamino)-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-2-ylprop-2-ynyl)piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 152768475 |
| Molecular Formula | C28H35N3O2S |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | [(3R,4R)-4-[3-(dimethylamino)-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-2-ylprop-2-ynyl)piperidin-3-yl]methanol |
| SMILES | COc1ccc2nccc(C(CCC3CCN(CC#Cc4cccs4)C[C@@H]3CO)N(C)C)c2c1 |
| InChI | InChI=1S/C28H35N3O2S/c1-30(2)28(25-12-14-29-27-10-9-23(33-3)18-26(25)27)11-8-21-13-16-31(19-22(21)20-32)15-4-6-24-7-5-17-34-24/h5,7,9-10,12,14,17-18,21-22,28,32H,8,11,13,15-16,19-20H2,1-3H3/t21?,22-,28?/m1/s1 |
| InChIKey | DNMLECFMBLFXIO-ZMJILXOLSA-N |
| XLogP | 4.67 |
| TPSA | 48.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|