C28H36N4O2S — CID 91078129
2-[(3R,4R)-4-[(3R)-3-(dimethylamino)-3-(6-methoxyquinolin-4-yl)propyl]-3-(hydroxymethyl)piperidin-1-yl]-1-pyridin-2-ylethanethione (PubChem CID 91078129) has the molecular formula C28H36N4O2S and a molecular weight of 492.69 g/mol. Its IUPAC name is 2-[(3R,4R)-4-[(3R)-3-(dimethylamino)-3-(6-methoxyquinolin-4-yl)propyl]-3-(hydroxymethyl)piperidin-1-yl]-1-pyridin-2-ylethanethione.
| Compound Name | 2-[(3R,4R)-4-[(3R)-3-(dimethylamino)-3-(6-methoxyquinolin-4-yl)propyl]-3-(hydroxymethyl)piperidin-1-yl]-1-pyridin-2-ylethanethione |
|---|---|
| PubChem CID | 91078129 |
| Molecular Formula | C28H36N4O2S |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | 2-[(3R,4R)-4-[(3R)-3-(dimethylamino)-3-(6-methoxyquinolin-4-yl)propyl]-3-(hydroxymethyl)piperidin-1-yl]-1-pyridin-2-ylethanethione |
| SMILES | COc1ccc2nccc([C@@H](CCC3CCN(CC(=S)c4ccccn4)C[C@@H]3CO)N(C)C)c2c1 |
| InChI | InChI=1S/C28H36N4O2S/c1-31(2)27(23-11-14-30-25-9-8-22(34-3)16-24(23)25)10-7-20-12-15-32(17-21(20)19-33)18-28(35)26-6-4-5-13-29-26/h4-6,8-9,11,13-14,16,20-21,27,33H,7,10,12,15,17-19H2,1-3H3/t20?,21-,27-/m1/s1 |
| InChIKey | PLNRPYQJXYZMHS-HUXCXIQZSA-N |
| XLogP | 4.37 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|