C27H29N2O3S- — CID 21347706
2-[(3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-2-ylprop-2-ynyl)piperidin-3-yl]acetate (PubChem CID 21347706) has the molecular formula C27H29N2O3S- and a molecular weight of 461.61 g/mol. Its IUPAC name is 2-[(3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-2-ylprop-2-ynyl)piperidin-3-yl]acetate.
| Compound Name | 2-[(3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-2-ylprop-2-ynyl)piperidin-3-yl]acetate |
|---|---|
| PubChem CID | 21347706 |
| Molecular Formula | C27H29N2O3S- |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 2-[(3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-2-ylprop-2-ynyl)piperidin-3-yl]acetate |
| SMILES | COc1ccc2nccc(CCC[C@@H]3CCN(CC#Cc4cccs4)C[C@@H]3CC(=O)[O-])c2c1 |
| InChI | InChI=1S/C27H30N2O3S/c1-32-23-9-10-26-25(18-23)21(11-13-28-26)6-2-5-20-12-15-29(19-22(20)17-27(30)31)14-3-7-24-8-4-16-33-24/h4,8-11,13,16,18,20,22H,2,5-6,12,14-15,17,19H2,1H3,(H,30,31)/p-1/t20-,22+/m1/s1 |
| InChIKey | DAWVFKBQXDAIPI-IRLDBZIGSA-M |
| XLogP | 3.76 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|