C10H14O2S — CID 152779777
3-methyl-1-penta-2,4-dienylsulfonylbuta-1,3-diene (PubChem CID 152779777) has the molecular formula C10H14O2S and a molecular weight of 198.29 g/mol. Its IUPAC name is 3-methyl-1-penta-2,4-dienylsulfonylbuta-1,3-diene.
| Compound Name | 3-methyl-1-penta-2,4-dienylsulfonylbuta-1,3-diene |
|---|---|
| PubChem CID | 152779777 |
| Molecular Formula | C10H14O2S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 3-methyl-1-penta-2,4-dienylsulfonylbuta-1,3-diene |
| SMILES | C=CC=CCS(=O)(=O)C=CC(=C)C |
| InChI | InChI=1S/C10H14O2S/c1-4-5-6-8-13(11,12)9-7-10(2)3/h4-7,9H,1-2,8H2,3H3 |
| InChIKey | JJBILAVOIINDPK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|