C10H14O5S2 — CID 87131613
3-methylbuta-1,3-dienylsulfonyl 3-methylbuta-1,3-diene-1-sulfonate (PubChem CID 87131613) has the molecular formula C10H14O5S2 and a molecular weight of 278.35 g/mol. Its IUPAC name is 3-methylbuta-1,3-dienylsulfonyl 3-methylbuta-1,3-diene-1-sulfonate.
| Compound Name | 3-methylbuta-1,3-dienylsulfonyl 3-methylbuta-1,3-diene-1-sulfonate |
|---|---|
| PubChem CID | 87131613 |
| Molecular Formula | C10H14O5S2 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 3-methylbuta-1,3-dienylsulfonyl 3-methylbuta-1,3-diene-1-sulfonate |
| SMILES | C=C(C)C=CS(=O)(=O)OS(=O)(=O)C=CC(=C)C |
| InChI | InChI=1S/C10H14O5S2/c1-9(2)5-7-16(11,12)15-17(13,14)8-6-10(3)4/h5-8H,1,3H2,2,4H3 |
| InChIKey | WYTDDODAIQBYIV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|