About 4-oxa-5λ2-stannatricyclo[4.2.1.03,7]nonan-2-yl 2-(2-methylprop-2-enoylsulfanyl)acetate
4-oxa-5λ2-stannatricyclo[4.2.1.03,7]nonan-2-yl 2-(2-methylprop-2-enoylsulfanyl)acetate (PubChem CID 152788668) has the molecular formula C13H16O4SSn
and a molecular weight of 387.05 g/mol. Its IUPAC name is 4-oxa-5λ2-stannatricyclo[4.2.1.03,7]nonan-2-yl 2-(2-methylprop-2-enoylsulfanyl)acetate.
Molecular Properties
| Compound Name | 4-oxa-5λ2-stannatricyclo[4.2.1.03,7]nonan-2-yl 2-(2-methylprop-2-enoylsulfanyl)acetate |
| PubChem CID | 152788668 |
| Molecular Formula | C13H16O4SSn |
| Molecular Weight | 387.05 g/mol |
| Exact Mass | 387.98 |
| IUPAC Name | 4-oxa-5λ2-stannatricyclo[4.2.1.03,7]nonan-2-yl 2-(2-methylprop-2-enoylsulfanyl)acetate |
| SMILES | C=C(C)C(=O)SCC(=O)OC1C2CC3[Sn]OC1C3C2 |
| InChI | InChI=1S/C13H16O4S.Sn/c1-7(2)13(16)18-6-10(14)17-12-9-4-3-8(5-9)11(12)15;/h3,8-9,11-12H,1,4-6H2,2H3;/q-1;+1 |
| InChIKey | SDJZTWGUDCRLAF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.05 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 4-oxa-5λ2-stannatricyclo[4.2.1.03,7]nonan-2-yl 2-(2-methylprop-2-enoylsulfanyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxa-5λ2-stannatricyclo[4.2.1.03,7]nonan-2-yl 2-(2-methylprop-2-enoylsulfanyl)acetate?
The IUPAC name of 4-oxa-5λ2-stannatricyclo[4.2.1.03,7]nonan-2-yl 2-(2-methylprop-2-enoylsulfanyl)acetate (CID 152788668) is 4-oxa-5λ2-stannatricyclo[4.2.1.03,7]nonan-2-yl 2-(2-methylprop-2-enoylsulfanyl)acetate.
What is the SMILES notation for 4-oxa-5λ2-stannatricyclo[4.2.1.03,7]nonan-2-yl 2-(2-methylprop-2-enoylsulfanyl)acetate?
The canonical SMILES for 4-oxa-5λ2-stannatricyclo[4.2.1.03,7]nonan-2-yl 2-(2-methylprop-2-enoylsulfanyl)acetate is C=C(C)C(=O)SCC(=O)OC1C2CC3[Sn]OC1C3C2.
What is the InChIKey of 4-oxa-5λ2-stannatricyclo[4.2.1.03,7]nonan-2-yl 2-(2-methylprop-2-enoylsulfanyl)acetate?
The InChIKey is SDJZTWGUDCRLAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O4S.Sn/c1-7(2)13(16)18-6-10(14)17-12-9-4-3-8(5-9)11(12)15;/h3,8-9,11-12H,1,4-6H2,2H3;/q-1;+1.
What are the key properties of 4-oxa-5λ2-stannatricyclo[4.2.1.03,7]nonan-2-yl 2-(2-methylprop-2-enoylsulfanyl)acetate?
4-oxa-5λ2-stannatricyclo[4.2.1.03,7]nonan-2-yl 2-(2-methylprop-2-enoylsulfanyl)acetate has a molecular weight of 387.05 g/mol, XLogP of 1.58, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxa-5λ2-stannatricyclo[4.2.1.03,7]nonan-2-yl 2-(2-methylprop-2-enoylsulfanyl)acetate is sourced from PubChem (CID 152788668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).