C12H8F15N — CID 152840863
1-[(E)-1,1,1,2,4,4,5,5,5-nonafluoropent-2-en-3-yl]-3,5-bis(trifluoromethyl)piperidine (PubChem CID 152840863) has the molecular formula C12H8F15N and a molecular weight of 451.17 g/mol. Its IUPAC name is 1-[(E)-1,1,1,2,4,4,5,5,5-nonafluoropent-2-en-3-yl]-3,5-bis(trifluoromethyl)piperidine.
| Compound Name | 1-[(E)-1,1,1,2,4,4,5,5,5-nonafluoropent-2-en-3-yl]-3,5-bis(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 152840863 |
| Molecular Formula | C12H8F15N |
| Molecular Weight | 451.17 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | 1-[(E)-1,1,1,2,4,4,5,5,5-nonafluoropent-2-en-3-yl]-3,5-bis(trifluoromethyl)piperidine |
| SMILES | F/C(=C(/N1CC(C(F)(F)F)CC(C(F)(F)F)C1)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H8F15N/c13-6(11(22,23)24)7(8(14,15)12(25,26)27)28-2-4(9(16,17)18)1-5(3-28)10(19,20)21/h4-5H,1-3H2/b7-6+ |
| InChIKey | SYSBTKBMKRJGAO-VOTSOKGWSA-N |
| XLogP | 5.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.17 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|