C13H8F17N — CID 146857948
1-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]-3,5-bis(trifluoromethyl)piperidine (PubChem CID 146857948) has the molecular formula C13H8F17N and a molecular weight of 501.18 g/mol. Its IUPAC name is 1-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]-3,5-bis(trifluoromethyl)piperidine.
| Compound Name | 1-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]-3,5-bis(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 146857948 |
| Molecular Formula | C13H8F17N |
| Molecular Weight | 501.18 g/mol |
| Exact Mass | 501.04 |
| IUPAC Name | 1-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]-3,5-bis(trifluoromethyl)piperidine |
| SMILES | FC(F)(F)C(=C(N1CC(C(F)(F)F)CC(C(F)(F)F)C1)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H8F17N/c14-8(15,13(28,29)30)7(6(11(22,23)24)12(25,26)27)31-2-4(9(16,17)18)1-5(3-31)10(19,20)21/h4-5H,1-3H2 |
| InChIKey | SJZBBDAEZQKAJY-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.18 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|