C11H9F12N — CID 163829700
1-[(E)-1,3,3,4,4,4-hexafluorobut-1-en-2-yl]-3,5-bis(trifluoromethyl)piperidine (PubChem CID 163829700) has the molecular formula C11H9F12N and a molecular weight of 383.18 g/mol. Its IUPAC name is 1-[(E)-1,3,3,4,4,4-hexafluorobut-1-en-2-yl]-3,5-bis(trifluoromethyl)piperidine.
| Compound Name | 1-[(E)-1,3,3,4,4,4-hexafluorobut-1-en-2-yl]-3,5-bis(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 163829700 |
| Molecular Formula | C11H9F12N |
| Molecular Weight | 383.18 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | 1-[(E)-1,3,3,4,4,4-hexafluorobut-1-en-2-yl]-3,5-bis(trifluoromethyl)piperidine |
| SMILES | F/C=C(/N1CC(C(F)(F)F)CC(C(F)(F)F)C1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H9F12N/c12-2-7(8(13,14)11(21,22)23)24-3-5(9(15,16)17)1-6(4-24)10(18,19)20/h2,5-6H,1,3-4H2/b7-2+ |
| InChIKey | OCPVFLBFTPXKQX-FARCUNLSSA-N |
| XLogP | 5.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.18 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|