C12H9F14N — CID 148985930
1-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]-4-(trifluoromethyl)piperidine (PubChem CID 148985930) has the molecular formula C12H9F14N and a molecular weight of 433.18 g/mol. Its IUPAC name is 1-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]-4-(trifluoromethyl)piperidine.
| Compound Name | 1-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]-4-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 148985930 |
| Molecular Formula | C12H9F14N |
| Molecular Weight | 433.18 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | 1-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]-4-(trifluoromethyl)piperidine |
| SMILES | FC(F)(F)C(=C(N1CCC(C(F)(F)F)CC1)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H9F14N/c13-8(14,12(24,25)26)7(6(10(18,19)20)11(21,22)23)27-3-1-5(2-4-27)9(15,16)17/h5H,1-4H2 |
| InChIKey | PWQZMGUVOBGVEA-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.18 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|