C25H23F3N2O5 — CID 152863787
1-[6-(2,6-difluorophenyl)-5-fluoro-2-pyridinyl]-2-[4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-5,6-dimethyloxan-2-yl]-3-pyridinyl]ethanone (PubChem CID 152863787) has the molecular formula C25H23F3N2O5 and a molecular weight of 488.46 g/mol. Its IUPAC name is 1-[6-(2,6-difluorophenyl)-5-fluoro-2-pyridinyl]-2-[4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-5,6-dimethyloxan-2-yl]-3-pyridinyl]ethanone.
| Compound Name | 1-[6-(2,6-difluorophenyl)-5-fluoro-2-pyridinyl]-2-[4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-5,6-dimethyloxan-2-yl]-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 152863787 |
| Molecular Formula | C25H23F3N2O5 |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 1-[6-(2,6-difluorophenyl)-5-fluoro-2-pyridinyl]-2-[4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-5,6-dimethyloxan-2-yl]-3-pyridinyl]ethanone |
| SMILES | C[C@H]1O[C@@H](c2ccncc2CC(=O)c2ccc(F)c(-c3c(F)cccc3F)n2)C(O)[C@@H](O)[C@]1(C)O |
| InChI | InChI=1S/C25H23F3N2O5/c1-12-25(2,34)24(33)22(32)23(35-12)14-8-9-29-11-13(14)10-19(31)18-7-6-17(28)21(30-18)20-15(26)4-3-5-16(20)27/h3-9,11-12,22-24,32-34H,10H2,1-2H3/t12-,22?,23+,24-,25-/m1/s1 |
| InChIKey | TYBGWDZNIHYHRO-RNDQMEECSA-N |
| XLogP | 2.92 |
| TPSA | 112.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |