C9H5N3O4S — CID 15290116
4-(benzenesulfonyl)-2-oxido-1,2,5-oxadiazol-2-ium-3-carbonitrile (PubChem CID 15290116) has the molecular formula C9H5N3O4S and a molecular weight of 251.22 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-2-oxido-1,2,5-oxadiazol-2-ium-3-carbonitrile.
| Compound Name | 4-(benzenesulfonyl)-2-oxido-1,2,5-oxadiazol-2-ium-3-carbonitrile |
|---|---|
| PubChem CID | 15290116 |
| Molecular Formula | C9H5N3O4S |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.00 |
| IUPAC Name | 4-(benzenesulfonyl)-2-oxido-1,2,5-oxadiazol-2-ium-3-carbonitrile |
| SMILES | N#Cc1c(S(=O)(=O)c2ccccc2)no[n+]1[O-] |
| InChI | InChI=1S/C9H5N3O4S/c10-6-8-9(11-16-12(8)13)17(14,15)7-4-2-1-3-5-7/h1-5H |
| InChIKey | SFPIYSHETFEEQG-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 110.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|