C21H25N7O2 — CID 152958648
(9Z)-16,25-dimethyl-4,5,12,15,16,19,25-heptazatetracyclo[19.3.1.12,5.014,18]hexacosa-1(24),2(26),3,9,14,17,22-heptaene-13,20-dione (PubChem CID 152958648) has the molecular formula C21H25N7O2 and a molecular weight of 407.48 g/mol. Its IUPAC name is (9Z)-16,25-dimethyl-4,5,12,15,16,19,25-heptazatetracyclo[19.3.1.12,5.014,18]hexacosa-1(24),2(26),3,9,14,17,22-heptaene-13,20-dione.
| Compound Name | (9Z)-16,25-dimethyl-4,5,12,15,16,19,25-heptazatetracyclo[19.3.1.12,5.014,18]hexacosa-1(24),2(26),3,9,14,17,22-heptaene-13,20-dione |
|---|---|
| PubChem CID | 152958648 |
| Molecular Formula | C21H25N7O2 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | (9Z)-16,25-dimethyl-4,5,12,15,16,19,25-heptazatetracyclo[19.3.1.12,5.014,18]hexacosa-1(24),2(26),3,9,14,17,22-heptaene-13,20-dione |
| SMILES | CN1C2=CC=CC1C(=O)Nc1cn(C)nc1C(=O)NC/C=C\CCCn1cc2cn1 |
| InChI | InChI=1S/C21H25N7O2/c1-26-14-16-19(25-26)21(30)22-10-5-3-4-6-11-28-13-15(12-23-28)17-8-7-9-18(27(17)2)20(29)24-16/h3,5,7-9,12-14,18H,4,6,10-11H2,1-2H3,(H,22,30)(H,24,29)/b5-3- |
| InChIKey | UQDAMXRAEILWKC-HYXAFXHYSA-N |
| XLogP | 1.55 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|