C5H9NO2 — CID 153007906
4-ethyl-1,2-oxazolidin-3-one (PubChem CID 153007906) has the molecular formula C5H9NO2 and a molecular weight of 115.13 g/mol. Its IUPAC name is 4-ethyl-1,2-oxazolidin-3-one.
| Compound Name | 4-ethyl-1,2-oxazolidin-3-one |
|---|---|
| PubChem CID | 153007906 |
| Molecular Formula | C5H9NO2 |
| Molecular Weight | 115.13 g/mol |
| Exact Mass | 115.06 |
| IUPAC Name | 4-ethyl-1,2-oxazolidin-3-one |
| SMILES | CCC1CONC1=O |
| InChI | InChI=1S/C5H9NO2/c1-2-4-3-8-6-5(4)7/h4H,2-3H2,1H3,(H,6,7) |
| InChIKey | UZMGBHWCKTWUDH-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.13 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |