C10H16N2O3 — CID 54339729
4-(5-oxoheptan-3-ylideneamino)-1,2-oxazolidin-3-one (PubChem CID 54339729) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 4-(5-oxoheptan-3-ylideneamino)-1,2-oxazolidin-3-one.
| Compound Name | 4-(5-oxoheptan-3-ylideneamino)-1,2-oxazolidin-3-one |
|---|---|
| PubChem CID | 54339729 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 4-(5-oxoheptan-3-ylideneamino)-1,2-oxazolidin-3-one |
| SMILES | CCC(=O)C/C(CC)=N/C1CONC1=O |
| InChI | InChI=1S/C10H16N2O3/c1-3-7(5-8(13)4-2)11-9-6-15-12-10(9)14/h9H,3-6H2,1-2H3,(H,12,14)/b11-7+ |
| InChIKey | TYBATWXNTYWSQJ-YRNVUSSQSA-N |
| XLogP | 0.64 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|