About (4Z)-6-fluoro-N,3-dimethylhepta-4,6-dien-2-amine
(4Z)-6-fluoro-N,3-dimethylhepta-4,6-dien-2-amine (PubChem CID 153166821) has the molecular formula C9H16FN
and a molecular weight of 157.23 g/mol. Its IUPAC name is (4Z)-6-fluoro-N,3-dimethylhepta-4,6-dien-2-amine.
Molecular Properties
| Compound Name | (4Z)-6-fluoro-N,3-dimethylhepta-4,6-dien-2-amine |
| PubChem CID | 153166821 |
| Molecular Formula | C9H16FN |
| Molecular Weight | 157.23 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | (4Z)-6-fluoro-N,3-dimethylhepta-4,6-dien-2-amine |
| SMILES | C=C(F)/C=C\C(C)C(C)NC |
| InChI | InChI=1S/C9H16FN/c1-7(9(3)11-4)5-6-8(2)10/h5-7,9,11H,2H2,1,3-4H3/b6-5- |
| InChIKey | WDKWVUQFMHVYIY-WAYWQWQTSA-N |
| XLogP | 2.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-6-fluoro-N,3-dimethylhepta-4,6-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-6-fluoro-N,3-dimethylhepta-4,6-dien-2-amine?
The IUPAC name of (4Z)-6-fluoro-N,3-dimethylhepta-4,6-dien-2-amine (CID 153166821) is (4Z)-6-fluoro-N,3-dimethylhepta-4,6-dien-2-amine.
What is the SMILES notation for (4Z)-6-fluoro-N,3-dimethylhepta-4,6-dien-2-amine?
The canonical SMILES for (4Z)-6-fluoro-N,3-dimethylhepta-4,6-dien-2-amine is C=C(F)/C=C\C(C)C(C)NC.
What is the InChIKey of (4Z)-6-fluoro-N,3-dimethylhepta-4,6-dien-2-amine?
The InChIKey is WDKWVUQFMHVYIY-WAYWQWQTSA-N. The full InChI is InChI=1S/C9H16FN/c1-7(9(3)11-4)5-6-8(2)10/h5-7,9,11H,2H2,1,3-4H3/b6-5-.
What are the key properties of (4Z)-6-fluoro-N,3-dimethylhepta-4,6-dien-2-amine?
(4Z)-6-fluoro-N,3-dimethylhepta-4,6-dien-2-amine has a molecular weight of 157.23 g/mol, XLogP of 2.27, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-6-fluoro-N,3-dimethylhepta-4,6-dien-2-amine is sourced from PubChem (CID 153166821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).