C9H16FN — CID 153166821
(4Z)-6-fluoro-N,3-dimethylhepta-4,6-dien-2-amine (PubChem CID 153166821) has the molecular formula C9H16FN and a molecular weight of 157.23 g/mol. Its IUPAC name is (4Z)-6-fluoro-N,3-dimethylhepta-4,6-dien-2-amine.
| Compound Name | (4Z)-6-fluoro-N,3-dimethylhepta-4,6-dien-2-amine |
|---|---|
| PubChem CID | 153166821 |
| Molecular Formula | C9H16FN |
| Molecular Weight | 157.23 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | (4Z)-6-fluoro-N,3-dimethylhepta-4,6-dien-2-amine |
| SMILES | C=C(F)/C=C\C(C)C(C)NC |
| InChI | InChI=1S/C9H16FN/c1-7(9(3)11-4)5-6-8(2)10/h5-7,9,11H,2H2,1,3-4H3/b6-5- |
| InChIKey | WDKWVUQFMHVYIY-WAYWQWQTSA-N |
| XLogP | 2.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|