C16H17NO3S — CID 15318315
3-(4-oxo-8-propylchromen-7-yl)oxypropyl thiocyanate (PubChem CID 15318315) has the molecular formula C16H17NO3S and a molecular weight of 303.38 g/mol. Its IUPAC name is 3-(4-oxo-8-propylchromen-7-yl)oxypropyl thiocyanate.
| Compound Name | 3-(4-oxo-8-propylchromen-7-yl)oxypropyl thiocyanate |
|---|---|
| PubChem CID | 15318315 |
| Molecular Formula | C16H17NO3S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 3-(4-oxo-8-propylchromen-7-yl)oxypropyl thiocyanate |
| SMILES | CCCc1c(OCCCSC#N)ccc2c(=O)ccoc12 |
| InChI | InChI=1S/C16H17NO3S/c1-2-4-13-15(19-8-3-10-21-11-17)6-5-12-14(18)7-9-20-16(12)13/h5-7,9H,2-4,8,10H2,1H3 |
| InChIKey | PNEOJIUAGXRCAW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 63.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|