C7H13Cl2NOS2 — CID 15322630
3,3-bis(2-chloroethylsulfanyl)propanamide (PubChem CID 15322630) has the molecular formula C7H13Cl2NOS2 and a molecular weight of 262.23 g/mol. Its IUPAC name is 3,3-bis(2-chloroethylsulfanyl)propanamide.
| Compound Name | 3,3-bis(2-chloroethylsulfanyl)propanamide |
|---|---|
| PubChem CID | 15322630 |
| Molecular Formula | C7H13Cl2NOS2 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 260.98 |
| IUPAC Name | 3,3-bis(2-chloroethylsulfanyl)propanamide |
| SMILES | NC(=O)CC(SCCCl)SCCCl |
| InChI | InChI=1S/C7H13Cl2NOS2/c8-1-3-12-7(5-6(10)11)13-4-2-9/h7H,1-5H2,(H2,10,11) |
| InChIKey | ZOYYVPFNLBFNOD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|