C39H36N5OPtS- — CID 153280429
2,4-ditert-butyl-6-[4-phenyl-6-[3-[(4-pyridin-4-yl-2-pyridinyl)sulfanyl]benzene-2-id-1-yl]-1,3,5-triazin-2-yl]phenol;platinum (PubChem CID 153280429) has the molecular formula C39H36N5OPtS- and a molecular weight of 817.90 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[4-phenyl-6-[3-[(4-pyridin-4-yl-2-pyridinyl)sulfanyl]benzene-2-id-1-yl]-1,3,5-triazin-2-yl]phenol;platinum.
| Compound Name | 2,4-ditert-butyl-6-[4-phenyl-6-[3-[(4-pyridin-4-yl-2-pyridinyl)sulfanyl]benzene-2-id-1-yl]-1,3,5-triazin-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 153280429 |
| Molecular Formula | C39H36N5OPtS- |
| Molecular Weight | 817.90 g/mol |
| Exact Mass | 817.23 |
| IUPAC Name | 2,4-ditert-butyl-6-[4-phenyl-6-[3-[(4-pyridin-4-yl-2-pyridinyl)sulfanyl]benzene-2-id-1-yl]-1,3,5-triazin-2-yl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(-c2nc(-c3[c-]c(Sc4cc(-c5ccncc5)ccn4)ccc3)nc(-c3ccccc3)n2)c(O)c(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C39H36N5OS.Pt/c1-38(2,3)29-23-31(34(45)32(24-29)39(4,5)6)37-43-35(26-11-8-7-9-12-26)42-36(44-37)28-13-10-14-30(21-28)46-33-22-27(17-20-41-33)25-15-18-40-19-16-25;/h7-20,22-24,45H,1-6H3;/q-1; |
| InChIKey | YIYQPIWWCYWERF-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 84.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.90 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|