C27H23F2N3O8S — CID 153289898
[2-(7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-9,12,14-trioxo-5-oxa-1,8,13-triazatricyclo[8.4.0.03,8]tetradec-10-en-11-yl]oxymethyl methyl carbonate (PubChem CID 153289898) has the molecular formula C27H23F2N3O8S and a molecular weight of 587.56 g/mol. Its IUPAC name is [2-(7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-9,12,14-trioxo-5-oxa-1,8,13-triazatricyclo[8.4.0.03,8]tetradec-10-en-11-yl]oxymethyl methyl carbonate.
| Compound Name | [2-(7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-9,12,14-trioxo-5-oxa-1,8,13-triazatricyclo[8.4.0.03,8]tetradec-10-en-11-yl]oxymethyl methyl carbonate |
|---|---|
| PubChem CID | 153289898 |
| Molecular Formula | C27H23F2N3O8S |
| Molecular Weight | 587.56 g/mol |
| Exact Mass | 587.12 |
| IUPAC Name | [2-(7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-9,12,14-trioxo-5-oxa-1,8,13-triazatricyclo[8.4.0.03,8]tetradec-10-en-11-yl]oxymethyl methyl carbonate |
| SMILES | COC(=O)OCOc1c2n(c(=O)[nH]c1=O)C(C1c3ccccc3SCc3c1ccc(F)c3F)C1COCCN1C2=O |
| InChI | InChI=1S/C27H23F2N3O8S/c1-37-27(36)40-12-39-23-22-25(34)31-8-9-38-10-17(31)21(32(22)26(35)30-24(23)33)19-13-6-7-16(28)20(29)15(13)11-41-18-5-3-2-4-14(18)19/h2-7,17,19,21H,8-12H2,1H3,(H,30,33,35) |
| InChIKey | VZPBKDGUJWTEMP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 129.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.56 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|