C28H22F2N2O7S — CID 172970306
[2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-9,12-dioxo-6-oxa-1,2-diazatricyclo[8.4.0.03,8]tetradeca-3(8),10,13-trien-11-yl]oxymethyl methyl carbonate (PubChem CID 172970306) has the molecular formula C28H22F2N2O7S and a molecular weight of 568.55 g/mol. Its IUPAC name is [2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-9,12-dioxo-6-oxa-1,2-diazatricyclo[8.4.0.03,8]tetradeca-3(8),10,13-trien-11-yl]oxymethyl methyl carbonate.
| Compound Name | [2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-9,12-dioxo-6-oxa-1,2-diazatricyclo[8.4.0.03,8]tetradeca-3(8),10,13-trien-11-yl]oxymethyl methyl carbonate |
|---|---|
| PubChem CID | 172970306 |
| Molecular Formula | C28H22F2N2O7S |
| Molecular Weight | 568.55 g/mol |
| Exact Mass | 568.11 |
| IUPAC Name | [2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-9,12-dioxo-6-oxa-1,2-diazatricyclo[8.4.0.03,8]tetradeca-3(8),10,13-trien-11-yl]oxymethyl methyl carbonate |
| SMILES | COC(=O)OCOc1c(=O)ccn2c1c(=O)c1c(n2[C@@H]2c3ccccc3SCc3c2ccc(F)c3F)CCOC1 |
| InChI | InChI=1S/C28H22F2N2O7S/c1-36-28(35)39-14-38-27-21(33)8-10-31-25(27)26(34)17-12-37-11-9-20(17)32(31)24-15-6-7-19(29)23(30)18(15)13-40-22-5-3-2-4-16(22)24/h2-8,10,24H,9,11-14H2,1H3/t24-/m0/s1 |
| InChIKey | DGIQPZOITVYMKE-DEOSSOPVSA-N |
| XLogP | 4.17 |
| TPSA | 97.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.55 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|