C31H43N5O6Si — CID 153293703
N-[9-[(4aR,6R,7R,7aR)-2,2-ditert-butyl-7-methyl-7-(oxan-2-yloxy)-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxasilin-6-yl]purin-6-yl]benzamide (PubChem CID 153293703) has the molecular formula C31H43N5O6Si and a molecular weight of 609.80 g/mol. Its IUPAC name is N-[9-[(4aR,6R,7R,7aR)-2,2-ditert-butyl-7-methyl-7-(oxan-2-yloxy)-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxasilin-6-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(4aR,6R,7R,7aR)-2,2-ditert-butyl-7-methyl-7-(oxan-2-yloxy)-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxasilin-6-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 153293703 |
| Molecular Formula | C31H43N5O6Si |
| Molecular Weight | 609.80 g/mol |
| Exact Mass | 609.30 |
| IUPAC Name | N-[9-[(4aR,6R,7R,7aR)-2,2-ditert-butyl-7-methyl-7-(oxan-2-yloxy)-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxasilin-6-yl]purin-6-yl]benzamide |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)OC[C@H]2O[C@@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)[C@](C)(OC3CCCCO3)[C@@H]2O1 |
| InChI | InChI=1S/C31H43N5O6Si/c1-29(2,3)43(30(4,5)6)39-17-21-24(42-43)31(7,41-22-15-11-12-16-38-22)28(40-21)36-19-34-23-25(32-18-33-26(23)36)35-27(37)20-13-9-8-10-14-20/h8-10,13-14,18-19,21-22,24,28H,11-12,15-17H2,1-7H3,(H,32,33,35,37)/t21-,22?,24-,28-,31-/m1/s1 |
| InChIKey | WLJFOAFZYHPKQR-MPSGZHIWSA-N |
| XLogP | 5.74 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.80 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|