About azanide;2-methanidylpropane;platinum(4+)
azanide;2-methanidylpropane;platinum(4+) (PubChem CID 153310938) has the molecular formula C4H12N2Pt
and a molecular weight of 283.23 g/mol. Its IUPAC name is azanide;2-methanidylpropane;platinum(4+).
Molecular Properties
| Compound Name | azanide;2-methanidylpropane;platinum(4+) |
| PubChem CID | 153310938 |
| Molecular Formula | C4H12N2Pt |
| Molecular Weight | 283.23 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | azanide;2-methanidylpropane;platinum(4+) |
| SMILES | [CH2-]C([CH2-])C.[NH2-].[NH2-].[Pt+4] |
| InChI | InChI=1S/C4H8.2H2N.Pt/c1-4(2)3;;;/h4H,1-2H2,3H3;2*1H2;/q-2;2*-1;+4 |
| InChIKey | AKVVJUBQAWRTGO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 67.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.23 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze azanide;2-methanidylpropane;platinum(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanide;2-methanidylpropane;platinum(4+)?
The IUPAC name of azanide;2-methanidylpropane;platinum(4+) (CID 153310938) is azanide;2-methanidylpropane;platinum(4+).
What is the SMILES notation for azanide;2-methanidylpropane;platinum(4+)?
The canonical SMILES for azanide;2-methanidylpropane;platinum(4+) is [CH2-]C([CH2-])C.[NH2-].[NH2-].[Pt+4].
What is the InChIKey of azanide;2-methanidylpropane;platinum(4+)?
The InChIKey is AKVVJUBQAWRTGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8.2H2N.Pt/c1-4(2)3;;;/h4H,1-2H2,3H3;2*1H2;/q-2;2*-1;+4.
What are the key properties of azanide;2-methanidylpropane;platinum(4+)?
azanide;2-methanidylpropane;platinum(4+) has a molecular weight of 283.23 g/mol, XLogP of 2.72, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for azanide;2-methanidylpropane;platinum(4+) is sourced from PubChem (CID 153310938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).