C19H38N2O5 — CID 153336658
N-ethyl-3-[2-[2-[2-[2-(hexylideneamino)ethoxy]ethoxy]ethoxy]ethoxy]propanamide (PubChem CID 153336658) has the molecular formula C19H38N2O5 and a molecular weight of 374.52 g/mol. Its IUPAC name is N-ethyl-3-[2-[2-[2-[2-(hexylideneamino)ethoxy]ethoxy]ethoxy]ethoxy]propanamide.
| Compound Name | N-ethyl-3-[2-[2-[2-[2-(hexylideneamino)ethoxy]ethoxy]ethoxy]ethoxy]propanamide |
|---|---|
| PubChem CID | 153336658 |
| Molecular Formula | C19H38N2O5 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | N-ethyl-3-[2-[2-[2-[2-(hexylideneamino)ethoxy]ethoxy]ethoxy]ethoxy]propanamide |
| SMILES | CCCCC/C=N/CCOCCOCCOCCOCCC(=O)NCC |
| InChI | InChI=1S/C19H38N2O5/c1-3-5-6-7-9-20-10-12-24-14-16-26-18-17-25-15-13-23-11-8-19(22)21-4-2/h9H,3-8,10-18H2,1-2H3,(H,21,22)/b20-9+ |
| InChIKey | LQMJIQLRGROKJO-AWQFTUOYSA-N |
| XLogP | 2.23 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|