C11H12FN3O2 — CID 153336898
(2Z,4E)-2-amino-5-(2-fluorophenyl)-3-hydrazinylpenta-2,4-dienoic acid (PubChem CID 153336898) has the molecular formula C11H12FN3O2 and a molecular weight of 237.23 g/mol. Its IUPAC name is (2Z,4E)-2-amino-5-(2-fluorophenyl)-3-hydrazinylpenta-2,4-dienoic acid.
| Compound Name | (2Z,4E)-2-amino-5-(2-fluorophenyl)-3-hydrazinylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 153336898 |
| Molecular Formula | C11H12FN3O2 |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | (2Z,4E)-2-amino-5-(2-fluorophenyl)-3-hydrazinylpenta-2,4-dienoic acid |
| SMILES | NNC(/C=C/c1ccccc1F)=C(\N)C(=O)O |
| InChI | InChI=1S/C11H12FN3O2/c12-8-4-2-1-3-7(8)5-6-9(15-14)10(13)11(16)17/h1-6,15H,13-14H2,(H,16,17)/b6-5+,10-9- |
| InChIKey | ZIIKGUBTSHRIHB-QMRMAQATSA-N |
| XLogP | 0.56 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|