C23H25ClO5S — CID 153338131
[2-[4-chloro-3-(4-ethoxybenzoyl)phenyl]-6-methylsulfanyloxan-4-yl] acetate (PubChem CID 153338131) has the molecular formula C23H25ClO5S and a molecular weight of 448.97 g/mol. Its IUPAC name is [2-[4-chloro-3-(4-ethoxybenzoyl)phenyl]-6-methylsulfanyloxan-4-yl] acetate.
| Compound Name | [2-[4-chloro-3-(4-ethoxybenzoyl)phenyl]-6-methylsulfanyloxan-4-yl] acetate |
|---|---|
| PubChem CID | 153338131 |
| Molecular Formula | C23H25ClO5S |
| Molecular Weight | 448.97 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | [2-[4-chloro-3-(4-ethoxybenzoyl)phenyl]-6-methylsulfanyloxan-4-yl] acetate |
| SMILES | CCOc1ccc(C(=O)c2cc(C3CC(OC(C)=O)CC(SC)O3)ccc2Cl)cc1 |
| InChI | InChI=1S/C23H25ClO5S/c1-4-27-17-8-5-15(6-9-17)23(26)19-11-16(7-10-20(19)24)21-12-18(28-14(2)25)13-22(29-21)30-3/h5-11,18,21-22H,4,12-13H2,1-3H3 |
| InChIKey | POUDNTFTDOHXLL-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.97 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |