C31H52F2N3O8P — CID 153339513
[(2S,5R,7R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-dihexoxyphosphoryloxy-6,6-difluoro-4-oxaspiro[2.4]heptan-7-yl] nonanoate (PubChem CID 153339513) has the molecular formula C31H52F2N3O8P and a molecular weight of 663.74 g/mol. Its IUPAC name is [(2S,5R,7R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-dihexoxyphosphoryloxy-6,6-difluoro-4-oxaspiro[2.4]heptan-7-yl] nonanoate.
| Compound Name | [(2S,5R,7R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-dihexoxyphosphoryloxy-6,6-difluoro-4-oxaspiro[2.4]heptan-7-yl] nonanoate |
|---|---|
| PubChem CID | 153339513 |
| Molecular Formula | C31H52F2N3O8P |
| Molecular Weight | 663.74 g/mol |
| Exact Mass | 663.35 |
| IUPAC Name | [(2S,5R,7R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-dihexoxyphosphoryloxy-6,6-difluoro-4-oxaspiro[2.4]heptan-7-yl] nonanoate |
| SMILES | CCCCCCCCC(=O)O[C@H]1C(F)(F)[C@H](n2ccc(N)nc2=O)OC12C[C@@H]2OP(=O)(OCCCCCC)OCCCCCC |
| InChI | InChI=1S/C31H52F2N3O8P/c1-4-7-10-13-14-15-18-26(37)42-27-30(43-28(31(27,32)33)36-20-19-25(34)35-29(36)38)23-24(30)44-45(39,40-21-16-11-8-5-2)41-22-17-12-9-6-3/h19-20,24,27-28H,4-18,21-23H2,1-3H3,(H2,34,35,38)/t24-,27+,28+,30?/m0/s1 |
| InChIKey | CDMWMEAGEYCIEF-DLBYBZOPSA-N |
| XLogP | 7.48 |
| TPSA | 141.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.74 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|