C25H31BO4 — CID 153350354
2-[5-[(6-ethyl-2,3-dimethylphenoxy)methyl]-1-benzofuran-7-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 153350354) has the molecular formula C25H31BO4 and a molecular weight of 406.33 g/mol. Its IUPAC name is 2-[5-[(6-ethyl-2,3-dimethylphenoxy)methyl]-1-benzofuran-7-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[5-[(6-ethyl-2,3-dimethylphenoxy)methyl]-1-benzofuran-7-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 153350354 |
| Molecular Formula | C25H31BO4 |
| Molecular Weight | 406.33 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 2-[5-[(6-ethyl-2,3-dimethylphenoxy)methyl]-1-benzofuran-7-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCc1ccc(C)c(C)c1OCc1cc(B2OC(C)(C)C(C)(C)O2)c2occc2c1 |
| InChI | InChI=1S/C25H31BO4/c1-8-19-10-9-16(2)17(3)22(19)28-15-18-13-20-11-12-27-23(20)21(14-18)26-29-24(4,5)25(6,7)30-26/h9-14H,8,15H2,1-7H3 |
| InChIKey | UJXUGLCVMFHXON-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 40.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.33 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|