C22H29N7O3S — CID 153356868
1-[3-[[3-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)-1H-1,2,4-triazol-5-yl]sulfonyl]-1-methylpyrazol-5-yl]-N,N-dimethylethanamine oxide (PubChem CID 153356868) has the molecular formula C22H29N7O3S and a molecular weight of 471.59 g/mol. Its IUPAC name is 1-[3-[[3-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)-1H-1,2,4-triazol-5-yl]sulfonyl]-1-methylpyrazol-5-yl]-N,N-dimethylethanamine oxide.
| Compound Name | 1-[3-[[3-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)-1H-1,2,4-triazol-5-yl]sulfonyl]-1-methylpyrazol-5-yl]-N,N-dimethylethanamine oxide |
|---|---|
| PubChem CID | 153356868 |
| Molecular Formula | C22H29N7O3S |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | 1-[3-[[3-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)-1H-1,2,4-triazol-5-yl]sulfonyl]-1-methylpyrazol-5-yl]-N,N-dimethylethanamine oxide |
| SMILES | CC(c1cc(S(=O)(=O)c2nc(Nc3c4c(cc5c3CCC5)CCC4)n[nH]2)nn1C)[N+](C)(C)[O-] |
| InChI | InChI=1S/C22H29N7O3S/c1-13(29(3,4)30)18-12-19(27-28(18)2)33(31,32)22-24-21(25-26-22)23-20-16-9-5-7-14(16)11-15-8-6-10-17(15)20/h11-13H,5-10H2,1-4H3,(H2,23,24,25,26) |
| InChIKey | NBUZQKXQUHIAKT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|