C27H44N6OS — CID 153357308
ethane;N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-5-[3-[methyl-[(1-methylpiperidin-4-yl)methyl]amino]propylsulfinyl]-1H-1,2,4-triazol-3-amine (PubChem CID 153357308) has the molecular formula C27H44N6OS and a molecular weight of 500.76 g/mol. Its IUPAC name is ethane;N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-5-[3-[methyl-[(1-methylpiperidin-4-yl)methyl]amino]propylsulfinyl]-1H-1,2,4-triazol-3-amine.
| Compound Name | ethane;N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-5-[3-[methyl-[(1-methylpiperidin-4-yl)methyl]amino]propylsulfinyl]-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 153357308 |
| Molecular Formula | C27H44N6OS |
| Molecular Weight | 500.76 g/mol |
| Exact Mass | 500.33 |
| IUPAC Name | ethane;N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-5-[3-[methyl-[(1-methylpiperidin-4-yl)methyl]amino]propylsulfinyl]-1H-1,2,4-triazol-3-amine |
| SMILES | CC.CN1CCC(CN(C)CCCS(=O)c2nc(Nc3c4c(cc5c3CCC5)CCC4)n[nH]2)CC1 |
| InChI | InChI=1S/C25H38N6OS.C2H6/c1-30-13-10-18(11-14-30)17-31(2)12-5-15-33(32)25-27-24(28-29-25)26-23-21-8-3-6-19(21)16-20-7-4-9-22(20)23;1-2/h16,18H,3-15,17H2,1-2H3,(H2,26,27,28,29);1-2H3 |
| InChIKey | VNFWFZGWHFUATH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.76 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |