C18H26N6S — CID 153357160
N-[[5-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)-1H-1,2,4-triazol-3-yl]sulfanyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 153357160) has the molecular formula C18H26N6S and a molecular weight of 358.52 g/mol. Its IUPAC name is N-[[5-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)-1H-1,2,4-triazol-3-yl]sulfanyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[[5-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)-1H-1,2,4-triazol-3-yl]sulfanyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 153357160 |
| Molecular Formula | C18H26N6S |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | N-[[5-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)-1H-1,2,4-triazol-3-yl]sulfanyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNSc1n[nH]c(Nc2c3c(cc4c2CCC4)CCC3)n1 |
| InChI | InChI=1S/C18H26N6S/c1-24(2)10-9-19-25-18-21-17(22-23-18)20-16-14-7-3-5-12(14)11-13-6-4-8-15(13)16/h11,19H,3-10H2,1-2H3,(H2,20,21,22,23) |
| InChIKey | SBLFXMXFOJAJTJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|