C20H29N5O2S — CID 150724489
5-[2-(diethylamino)ethylsulfonyl]-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-1H-1,2,4-triazol-3-amine (PubChem CID 150724489) has the molecular formula C20H29N5O2S and a molecular weight of 403.55 g/mol. Its IUPAC name is 5-[2-(diethylamino)ethylsulfonyl]-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-[2-(diethylamino)ethylsulfonyl]-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 150724489 |
| Molecular Formula | C20H29N5O2S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 5-[2-(diethylamino)ethylsulfonyl]-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-1H-1,2,4-triazol-3-amine |
| SMILES | CCN(CC)CCS(=O)(=O)c1nc(Nc2c3c(cc4c2CCC4)CCC3)n[nH]1 |
| InChI | InChI=1S/C20H29N5O2S/c1-3-25(4-2)11-12-28(26,27)20-22-19(23-24-20)21-18-16-9-5-7-14(16)13-15-8-6-10-17(15)18/h13H,3-12H2,1-2H3,(H2,21,22,23,24) |
| InChIKey | JQNPGDVONOVZQC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |