C19H24N4O3S — CID 151437111
N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-5-(oxolan-3-ylmethylsulfonyl)-1H-1,2,4-triazol-3-amine (PubChem CID 151437111) has the molecular formula C19H24N4O3S and a molecular weight of 388.49 g/mol. Its IUPAC name is N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-5-(oxolan-3-ylmethylsulfonyl)-1H-1,2,4-triazol-3-amine.
| Compound Name | N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-5-(oxolan-3-ylmethylsulfonyl)-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 151437111 |
| Molecular Formula | C19H24N4O3S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-5-(oxolan-3-ylmethylsulfonyl)-1H-1,2,4-triazol-3-amine |
| SMILES | O=S(=O)(CC1CCOC1)c1nc(Nc2c3c(cc4c2CCC4)CCC3)n[nH]1 |
| InChI | InChI=1S/C19H24N4O3S/c24-27(25,11-12-7-8-26-10-12)19-21-18(22-23-19)20-17-15-5-1-3-13(15)9-14-4-2-6-16(14)17/h9,12H,1-8,10-11H2,(H2,20,21,22,23) |
| InChIKey | PDSWFSACSOEDIS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |