C28H36N7O3P — CID 153366407
4-N-(2-dimethoxyphosphanylphenyl)-2-N-[4-[4-(dimethylamino)piperidin-1-yl]-3-methoxyphenyl]-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine (PubChem CID 153366407) has the molecular formula C28H36N7O3P and a molecular weight of 549.62 g/mol. Its IUPAC name is 4-N-(2-dimethoxyphosphanylphenyl)-2-N-[4-[4-(dimethylamino)piperidin-1-yl]-3-methoxyphenyl]-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(2-dimethoxyphosphanylphenyl)-2-N-[4-[4-(dimethylamino)piperidin-1-yl]-3-methoxyphenyl]-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 153366407 |
| Molecular Formula | C28H36N7O3P |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.26 |
| IUPAC Name | 4-N-(2-dimethoxyphosphanylphenyl)-2-N-[4-[4-(dimethylamino)piperidin-1-yl]-3-methoxyphenyl]-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
| SMILES | COc1cc(Nc2nc(Nc3ccccc3P(OC)OC)c3cc[nH]c3n2)ccc1N1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C28H36N7O3P/c1-34(2)20-13-16-35(17-14-20)23-11-10-19(18-24(23)36-3)30-28-32-26-21(12-15-29-26)27(33-28)31-22-8-6-7-9-25(22)39(37-4)38-5/h6-12,15,18,20H,13-14,16-17H2,1-5H3,(H3,29,30,31,32,33) |
| InChIKey | DKGJVCNDWYLFPR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 99.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|