C20H21OP2S2+ — CID 153369947
[4-hydroxy-3,5-bis(methylsulfanyl)phenyl]-diphenyl-phosphanylphosphanium (PubChem CID 153369947) has the molecular formula C20H21OP2S2+ and a molecular weight of 403.47 g/mol. Its IUPAC name is [4-hydroxy-3,5-bis(methylsulfanyl)phenyl]-diphenyl-phosphanylphosphanium.
| Compound Name | [4-hydroxy-3,5-bis(methylsulfanyl)phenyl]-diphenyl-phosphanylphosphanium |
|---|---|
| PubChem CID | 153369947 |
| Molecular Formula | C20H21OP2S2+ |
| Molecular Weight | 403.47 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | [4-hydroxy-3,5-bis(methylsulfanyl)phenyl]-diphenyl-phosphanylphosphanium |
| SMILES | CSc1cc([P+](P)(c2ccccc2)c2ccccc2)cc(SC)c1O |
| InChI | InChI=1S/C20H20OP2S2/c1-24-18-13-17(14-19(25-2)20(18)21)23(22,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-14H,22H2,1-2H3/p+1 |
| InChIKey | YFKZCPSTZSPKAW-UHFFFAOYSA-O |
| XLogP | 4.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|