C31H32FN3O — CID 153375677
(5aR,6R,9aR)-3-[(2-fluorophenyl)methyl]-5a,6,9a-trimethyl-7-oxo-2-(4-propan-2-ylphenyl)-5,6-dihydro-4H-benzo[e]benzimidazole-8-carbonitrile (PubChem CID 153375677) has the molecular formula C31H32FN3O and a molecular weight of 481.62 g/mol. Its IUPAC name is (5aR,6R,9aR)-3-[(2-fluorophenyl)methyl]-5a,6,9a-trimethyl-7-oxo-2-(4-propan-2-ylphenyl)-5,6-dihydro-4H-benzo[e]benzimidazole-8-carbonitrile.
| Compound Name | (5aR,6R,9aR)-3-[(2-fluorophenyl)methyl]-5a,6,9a-trimethyl-7-oxo-2-(4-propan-2-ylphenyl)-5,6-dihydro-4H-benzo[e]benzimidazole-8-carbonitrile |
|---|---|
| PubChem CID | 153375677 |
| Molecular Formula | C31H32FN3O |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | (5aR,6R,9aR)-3-[(2-fluorophenyl)methyl]-5a,6,9a-trimethyl-7-oxo-2-(4-propan-2-ylphenyl)-5,6-dihydro-4H-benzo[e]benzimidazole-8-carbonitrile |
| SMILES | CC(C)c1ccc(-c2nc3c(n2Cc2ccccc2F)CC[C@]2(C)[C@@H](C)C(=O)C(C#N)=C[C@@]32C)cc1 |
| InChI | InChI=1S/C31H32FN3O/c1-19(2)21-10-12-22(13-11-21)29-34-28-26(35(29)18-23-8-6-7-9-25(23)32)14-15-30(4)20(3)27(36)24(17-33)16-31(28,30)5/h6-13,16,19-20H,14-15,18H2,1-5H3/t20-,30+,31-/m0/s1 |
| InChIKey | YTJYJAPYMIZPRV-IDFCWKQJSA-N |
| XLogP | 6.74 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |