C14H24N2 — CID 153378976
7,7-dimethylimidazo[1,2-a]azepine;ethane (PubChem CID 153378976) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 7,7-dimethylimidazo[1,2-a]azepine;ethane.
| Compound Name | 7,7-dimethylimidazo[1,2-a]azepine;ethane |
|---|---|
| PubChem CID | 153378976 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 7,7-dimethylimidazo[1,2-a]azepine;ethane |
| SMILES | CC.CC.CC1(C)C=Cc2nccn2C=C1 |
| InChI | InChI=1S/C10H12N2.2C2H6/c1-10(2)4-3-9-11-6-8-12(9)7-5-10;2*1-2/h3-8H,1-2H3;2*1-2H3 |
| InChIKey | YUBYUOZDWJYWBY-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |