C19H39FN2O13P2S — CID 153387086
fluoro 6-[3-[2-oxo-2-[2-[2-[2-(2-phosphonooxyethoxy)ethoxy]ethoxy]ethylamino]ethyl]sulfanylpropanoylamino]hexyl hydrogen phosphate (PubChem CID 153387086) has the molecular formula C19H39FN2O13P2S and a molecular weight of 616.53 g/mol. Its IUPAC name is fluoro 6-[3-[2-oxo-2-[2-[2-[2-(2-phosphonooxyethoxy)ethoxy]ethoxy]ethylamino]ethyl]sulfanylpropanoylamino]hexyl hydrogen phosphate.
| Compound Name | fluoro 6-[3-[2-oxo-2-[2-[2-[2-(2-phosphonooxyethoxy)ethoxy]ethoxy]ethylamino]ethyl]sulfanylpropanoylamino]hexyl hydrogen phosphate |
|---|---|
| PubChem CID | 153387086 |
| Molecular Formula | C19H39FN2O13P2S |
| Molecular Weight | 616.53 g/mol |
| Exact Mass | 616.16 |
| IUPAC Name | fluoro 6-[3-[2-oxo-2-[2-[2-[2-(2-phosphonooxyethoxy)ethoxy]ethoxy]ethylamino]ethyl]sulfanylpropanoylamino]hexyl hydrogen phosphate |
| SMILES | O=C(CCSCC(=O)NCCOCCOCCOCCOP(=O)(O)O)NCCCCCCOP(=O)(O)OF |
| InChI | InChI=1S/C19H39FN2O13P2S/c20-35-37(28,29)34-8-4-2-1-3-6-21-18(23)5-16-38-17-19(24)22-7-9-30-10-11-31-12-13-32-14-15-33-36(25,26)27/h1-17H2,(H,21,23)(H,22,24)(H,28,29)(H2,25,26,27) |
| InChIKey | REAOPKDFNNOFCA-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 208.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.53 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|