About N-ethyl-N-methylpropan-1-amine;manganese
N-ethyl-N-methylpropan-1-amine;manganese (PubChem CID 153387648) has the molecular formula C6H14MnN-
and a molecular weight of 155.12 g/mol. Its IUPAC name is N-ethyl-N-methylpropan-1-amine;manganese.
Molecular Properties
| Compound Name | N-ethyl-N-methylpropan-1-amine;manganese |
| PubChem CID | 153387648 |
| Molecular Formula | C6H14MnN- |
| Molecular Weight | 155.12 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | N-ethyl-N-methylpropan-1-amine;manganese |
| SMILES | [CH2-]CN(C)CCC.[Mn] |
| InChI | InChI=1S/C6H14N.Mn/c1-4-6-7(3)5-2;/h2,4-6H2,1,3H3;/q-1; |
| InChIKey | AWSKTTVVEPSEGU-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.12 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-methylpropan-1-amine;manganese with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-methylpropan-1-amine;manganese?
The IUPAC name of N-ethyl-N-methylpropan-1-amine;manganese (CID 153387648) is N-ethyl-N-methylpropan-1-amine;manganese.
What is the SMILES notation for N-ethyl-N-methylpropan-1-amine;manganese?
The canonical SMILES for N-ethyl-N-methylpropan-1-amine;manganese is [CH2-]CN(C)CCC.[Mn].
What is the InChIKey of N-ethyl-N-methylpropan-1-amine;manganese?
The InChIKey is AWSKTTVVEPSEGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N.Mn/c1-4-6-7(3)5-2;/h2,4-6H2,1,3H3;/q-1;.
What are the key properties of N-ethyl-N-methylpropan-1-amine;manganese?
N-ethyl-N-methylpropan-1-amine;manganese has a molecular weight of 155.12 g/mol, XLogP of 1.16, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-methylpropan-1-amine;manganese is sourced from PubChem (CID 153387648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).