About CID 153390108
CID 153390108 (PubChem CID 153390108) has the molecular formula C13H24NRb
and a molecular weight of 279.81 g/mol.
Molecular Properties
| Compound Name | CID 153390108 |
| PubChem CID | 153390108 |
| Molecular Formula | C13H24NRb |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | — |
| SMILES | CCN1CCCC2(CC[C-](C)CC2)C1.[Rb+] |
| InChI | InChI=1S/C13H24N.Rb/c1-3-14-10-4-7-13(11-14)8-5-12(2)6-9-13;/h3-11H2,1-2H3;/q-1;+1 |
| InChIKey | BTJLIVHEGCNKAA-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 153390108 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153390108?
The IUPAC name of CID 153390108 (CID 153390108) is not available.
What is the SMILES notation for CID 153390108?
The canonical SMILES for CID 153390108 is CCN1CCCC2(CC[C-](C)CC2)C1.[Rb+].
What is the InChIKey of CID 153390108?
The InChIKey is BTJLIVHEGCNKAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N.Rb/c1-3-14-10-4-7-13(11-14)8-5-12(2)6-9-13;/h3-11H2,1-2H3;/q-1;+1.
What are the key properties of CID 153390108?
CID 153390108 has a molecular weight of 279.81 g/mol, XLogP of 0.26, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153390108 is sourced from PubChem (CID 153390108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).