C13H10N4O2S — CID 153391029
2-amino-2-oxo-N-[(2-phenyl-1,3-thiazol-4-yl)methoxy]ethanimidoyl cyanide (PubChem CID 153391029) has the molecular formula C13H10N4O2S and a molecular weight of 286.32 g/mol. Its IUPAC name is 2-amino-2-oxo-N-[(2-phenyl-1,3-thiazol-4-yl)methoxy]ethanimidoyl cyanide.
| Compound Name | 2-amino-2-oxo-N-[(2-phenyl-1,3-thiazol-4-yl)methoxy]ethanimidoyl cyanide |
|---|---|
| PubChem CID | 153391029 |
| Molecular Formula | C13H10N4O2S |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 2-amino-2-oxo-N-[(2-phenyl-1,3-thiazol-4-yl)methoxy]ethanimidoyl cyanide |
| SMILES | N#CC(=NOCc1csc(-c2ccccc2)n1)C(N)=O |
| InChI | InChI=1S/C13H10N4O2S/c14-6-11(12(15)18)17-19-7-10-8-20-13(16-10)9-4-2-1-3-5-9/h1-5,8H,7H2,(H2,15,18) |
| InChIKey | PSTMWOUXWXDGMW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|