C5H9N4O2P — CID 153427100
1-(phosphanylideneamino)oxy-3-(1,2,4-triazol-1-yl)propan-2-ol (PubChem CID 153427100) has the molecular formula C5H9N4O2P and a molecular weight of 188.13 g/mol. Its IUPAC name is 1-(phosphanylideneamino)oxy-3-(1,2,4-triazol-1-yl)propan-2-ol.
| Compound Name | 1-(phosphanylideneamino)oxy-3-(1,2,4-triazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 153427100 |
| Molecular Formula | C5H9N4O2P |
| Molecular Weight | 188.13 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | 1-(phosphanylideneamino)oxy-3-(1,2,4-triazol-1-yl)propan-2-ol |
| SMILES | [H]/P=N/OCC(O)Cn1cncn1 |
| InChI | InChI=1S/C5H9N4O2P/c10-5(2-11-8-12)1-9-4-6-3-7-9/h3-5,10,12H,1-2H2 |
| InChIKey | VKWDZYILXQUKAN-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.13 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|