C30H43NO6 — CID 153429226
[7-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyloxy]-8-methylnonan-3-yl] naphthalene-2-carboxylate (PubChem CID 153429226) has the molecular formula C30H43NO6 and a molecular weight of 513.68 g/mol. Its IUPAC name is [7-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyloxy]-8-methylnonan-3-yl] naphthalene-2-carboxylate.
| Compound Name | [7-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyloxy]-8-methylnonan-3-yl] naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 153429226 |
| Molecular Formula | C30H43NO6 |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.31 |
| IUPAC Name | [7-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyloxy]-8-methylnonan-3-yl] naphthalene-2-carboxylate |
| SMILES | CCC(CCCC(OC(=O)NCCOC(=O)C(C)(C)CC)C(C)C)OC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C30H43NO6/c1-7-25(36-27(32)24-17-16-22-12-9-10-13-23(22)20-24)14-11-15-26(21(3)4)37-29(34)31-18-19-35-28(33)30(5,6)8-2/h9-10,12-13,16-17,20-21,25-26H,7-8,11,14-15,18-19H2,1-6H3,(H,31,34) |
| InChIKey | KXFXRGVZENGIHI-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|