C20H19FN2O7S — CID 153430865
methyl 2-[6-fluoro-1-[[2-(2-methoxyethoxy)acetyl]oxymethyl]indole-3-carbonyl]-1,3-thiazole-4-carboxylate (PubChem CID 153430865) has the molecular formula C20H19FN2O7S and a molecular weight of 450.44 g/mol. Its IUPAC name is methyl 2-[6-fluoro-1-[[2-(2-methoxyethoxy)acetyl]oxymethyl]indole-3-carbonyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[6-fluoro-1-[[2-(2-methoxyethoxy)acetyl]oxymethyl]indole-3-carbonyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 153430865 |
| Molecular Formula | C20H19FN2O7S |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | methyl 2-[6-fluoro-1-[[2-(2-methoxyethoxy)acetyl]oxymethyl]indole-3-carbonyl]-1,3-thiazole-4-carboxylate |
| SMILES | COCCOCC(=O)OCn1cc(C(=O)c2nc(C(=O)OC)cs2)c2ccc(F)cc21 |
| InChI | InChI=1S/C20H19FN2O7S/c1-27-5-6-29-9-17(24)30-11-23-8-14(13-4-3-12(21)7-16(13)23)18(25)19-22-15(10-31-19)20(26)28-2/h3-4,7-8,10H,5-6,9,11H2,1-2H3 |
| InChIKey | RNJFJZJJQCZVBC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 105.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|