C37H33IrN2O3- — CID 153433098
5-cyclopentylpyridine-2-carboxylic acid;2-(9,9-dimethyl-2H-xanthen-2-id-1-yl)-5-phenylpyridine;iridium (PubChem CID 153433098) has the molecular formula C37H33IrN2O3- and a molecular weight of 745.90 g/mol. Its IUPAC name is 5-cyclopentylpyridine-2-carboxylic acid;2-(9,9-dimethyl-2H-xanthen-2-id-1-yl)-5-phenylpyridine;iridium.
| Compound Name | 5-cyclopentylpyridine-2-carboxylic acid;2-(9,9-dimethyl-2H-xanthen-2-id-1-yl)-5-phenylpyridine;iridium |
|---|---|
| PubChem CID | 153433098 |
| Molecular Formula | C37H33IrN2O3- |
| Molecular Weight | 745.90 g/mol |
| Exact Mass | 746.21 |
| IUPAC Name | 5-cyclopentylpyridine-2-carboxylic acid;2-(9,9-dimethyl-2H-xanthen-2-id-1-yl)-5-phenylpyridine;iridium |
| SMILES | CC1(C)c2ccccc2Oc2cc[c-]c(-c3ccc(-c4ccccc4)cn3)c21.O=C(O)c1ccc(C2CCCC2)cn1.[Ir] |
| InChI | InChI=1S/C26H20NO.C11H13NO2.Ir/c1-26(2)21-12-6-7-13-23(21)28-24-14-8-11-20(25(24)26)22-16-15-19(17-27-22)18-9-4-3-5-10-18;13-11(14)10-6-5-9(7-12-10)8-3-1-2-4-8;/h3-10,12-17H,1-2H3;5-8H,1-4H2,(H,13,14);/q-1;; |
| InChIKey | JVCVSEJCSDEOAY-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.90 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|