C27H24IO2S- — CID 153448816
1-[dimethoxy(phenyl)methyl]-4-(4-phenyliodanuidylphenyl)sulfanylbenzene (PubChem CID 153448816) has the molecular formula C27H24IO2S- and a molecular weight of 539.46 g/mol. Its IUPAC name is 1-[dimethoxy(phenyl)methyl]-4-(4-phenyliodanuidylphenyl)sulfanylbenzene.
| Compound Name | 1-[dimethoxy(phenyl)methyl]-4-(4-phenyliodanuidylphenyl)sulfanylbenzene |
|---|---|
| PubChem CID | 153448816 |
| Molecular Formula | C27H24IO2S- |
| Molecular Weight | 539.46 g/mol |
| Exact Mass | 539.05 |
| IUPAC Name | 1-[dimethoxy(phenyl)methyl]-4-(4-phenyliodanuidylphenyl)sulfanylbenzene |
| SMILES | COC(OC)(c1ccccc1)c1ccc(Sc2ccc([I-]c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C27H24IO2S/c1-29-27(30-2,21-9-5-3-6-10-21)22-13-17-25(18-14-22)31-26-19-15-24(16-20-26)28-23-11-7-4-8-12-23/h3-20H,1-2H3/q-1 |
| InChIKey | HEJHOYWSZAIYBL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|