C15H18BrNO2 — CID 153450359
6-(2-bromo-4-ethoxyphenyl)-1-ethyl-3,4-dihydropyridin-2-one (PubChem CID 153450359) has the molecular formula C15H18BrNO2 and a molecular weight of 324.22 g/mol. Its IUPAC name is 6-(2-bromo-4-ethoxyphenyl)-1-ethyl-3,4-dihydropyridin-2-one.
| Compound Name | 6-(2-bromo-4-ethoxyphenyl)-1-ethyl-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 153450359 |
| Molecular Formula | C15H18BrNO2 |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 6-(2-bromo-4-ethoxyphenyl)-1-ethyl-3,4-dihydropyridin-2-one |
| SMILES | CCOc1ccc(C2=CCCC(=O)N2CC)c(Br)c1 |
| InChI | InChI=1S/C15H18BrNO2/c1-3-17-14(6-5-7-15(17)18)12-9-8-11(19-4-2)10-13(12)16/h6,8-10H,3-5,7H2,1-2H3 |
| InChIKey | FVBYHWQWUWLRKE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |