C24H36O14 — CID 153469187
2-[(E)-3-[[(3R,4S,6R)-4,5-bis[(E)-3-(carboxymethoxy)prop-2-enoxy]-3-ethyl-6-methoxyoxan-2-yl]methoxy]prop-1-enoxy]acetic acid (PubChem CID 153469187) has the molecular formula C24H36O14 and a molecular weight of 548.54 g/mol. Its IUPAC name is 2-[(E)-3-[[(3R,4S,6R)-4,5-bis[(E)-3-(carboxymethoxy)prop-2-enoxy]-3-ethyl-6-methoxyoxan-2-yl]methoxy]prop-1-enoxy]acetic acid.
| Compound Name | 2-[(E)-3-[[(3R,4S,6R)-4,5-bis[(E)-3-(carboxymethoxy)prop-2-enoxy]-3-ethyl-6-methoxyoxan-2-yl]methoxy]prop-1-enoxy]acetic acid |
|---|---|
| PubChem CID | 153469187 |
| Molecular Formula | C24H36O14 |
| Molecular Weight | 548.54 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | 2-[(E)-3-[[(3R,4S,6R)-4,5-bis[(E)-3-(carboxymethoxy)prop-2-enoxy]-3-ethyl-6-methoxyoxan-2-yl]methoxy]prop-1-enoxy]acetic acid |
| SMILES | CC[C@@H]1C(COC/C=C/OCC(=O)O)O[C@@H](OC)C(OC/C=C/OCC(=O)O)[C@H]1OC/C=C/OCC(=O)O |
| InChI | InChI=1S/C24H36O14/c1-3-17-18(13-32-7-4-8-33-14-19(25)26)38-24(31-2)23(37-12-6-10-35-16-21(29)30)22(17)36-11-5-9-34-15-20(27)28/h4-6,8-10,17-18,22-24H,3,7,11-16H2,1-2H3,(H,25,26)(H,27,28)(H,29,30)/b8-4+,9-5+,10-6+/t17-,18?,22+,23?,24-/m1/s1 |
| InChIKey | NQRPXANUTUDQQH-QGISOPSSSA-N |
| XLogP | 1.02 |
| TPSA | 185.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.54 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|