C15H16NO+ — CID 153488295
3-tert-butylbenzo[f][1,3]benzoxazol-3-ium (PubChem CID 153488295) has the molecular formula C15H16NO+ and a molecular weight of 226.30 g/mol. Its IUPAC name is 3-tert-butylbenzo[f][1,3]benzoxazol-3-ium.
| Compound Name | 3-tert-butylbenzo[f][1,3]benzoxazol-3-ium |
|---|---|
| PubChem CID | 153488295 |
| Molecular Formula | C15H16NO+ |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 3-tert-butylbenzo[f][1,3]benzoxazol-3-ium |
| SMILES | CC(C)(C)[n+]1coc2cc3ccccc3cc21 |
| InChI | InChI=1S/C15H16NO/c1-15(2,3)16-10-17-14-9-12-7-5-4-6-11(12)8-13(14)16/h4-10H,1-3H3/q+1 |
| InChIKey | OMQUJQOUCLNVGZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|